Difference between revisions of "Ec-07 003680"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Ec-07_003680 == * left end position: ** 3727476 * transcription direction: ** POSITIVE * right end position: ** 3738628 * centisome position: ** 48.2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_003680 == |
− | * | + | * left end position: |
− | ** | + | ** 3727476 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3738628 |
− | * | + | * centisome position: |
− | ** | + | ** 48.268173 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0046_0098 |
− | ** | + | ** Esi0046_0098 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ADENYL-KIN-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[RXN-11832]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-12002]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-7913]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
+ | * [[PWY-7205]] | ||
+ | * [[PWY-7197]] | ||
+ | * [[PWY-7176]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3727476}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3738628}} | |
− | + | {{#set: centisome position=48.268173 }} | |
− | + | {{#set: common name=Esi_0046_0098|Esi0046_0098}} | |
− | + | {{#set: reaction associated=ADENYL-KIN-RXN|RXN-11832|RXN-12002|RXN-7913}} | |
− | + | {{#set: pathway associated=PWY-7219|PWY-7205|PWY-7197|PWY-7176}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:22, 21 March 2018
Gene Ec-07_003680
- left end position:
- 3727476
- transcription direction:
- POSITIVE
- right end position:
- 3738628
- centisome position:
- 48.268173
- Synonym(s):
- Esi_0046_0098
- Esi0046_0098
Reactions associated
- Reaction: ADENYL-KIN-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-11832
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-12002
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-7913
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome