Difference between revisions of "B-ALANINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALACETIC_ACID OXALACETIC_ACID] == * smiles: ** C(C([O-])=O)C(=O)C([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-ALANINE B-ALANINE] == * smiles: ** C(C[N+])C([O-])=O * inchi key: ** InChIKey=UCMIRNVEIXFBKS-...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=B-ALANINE B-ALANINE] == |
* smiles: | * smiles: | ||
| − | ** C(C | + | ** C(C[N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UCMIRNVEIXFBKS-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** β-alanine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 89.094 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-azaniumylpropanoate |
| − | ** | + | ** 3-ammoniopropanoate |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[BETA-UREIDOPROPIONASE-RXN]] |
| − | * [[ | + | * [[RXN-6382]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 107-95-9 |
| − | * BIGG : | + | * BIGG : 33848 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4755801 4755801] |
| − | * HMDB : | + | * HMDB : HMDB00056 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00099 C00099] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57966 57966] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC57966 |
| − | {{#set: smiles=C(C | + | {{#set: smiles=C(C[N+])C([O-])=O}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=UCMIRNVEIXFBKS-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=β-alanine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=89.094 }} |
| − | {{#set: common name= | + | {{#set: common name=3-azaniumylpropanoate|3-ammoniopropanoate}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}} |
| − | + | {{#set: produced by=BETA-UREIDOPROPIONASE-RXN|RXN-6382}} | |
| − | {{#set: | + | |
Latest revision as of 19:22, 21 March 2018
Contents
Metabolite B-ALANINE
- smiles:
- C(C[N+])C([O-])=O
- inchi key:
- InChIKey=UCMIRNVEIXFBKS-UHFFFAOYSA-N
- common name:
- β-alanine
- molecular weight:
- 89.094
- Synonym(s):
- 3-azaniumylpropanoate
- 3-ammoniopropanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 107-95-9
- BIGG : 33848
- PUBCHEM:
- HMDB : HMDB00056
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57966
"C(C[N+])C([O-])=O" cannot be used as a page name in this wiki.
