Difference between revisions of "PWY-7574"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7574 PWY-7574] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7574 PWY-7574] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
+
** propanoyl-CoA degradation II
* molecular weight:
+
** 1015.898   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-16:1-Δ7-CoA
+
** propionyl-CoA degradation II
** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17781]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-2902]]
* [[RXN-17780]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-10_003810]]
 +
*** [[Ec-06_003440]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-6383]]
 +
** 2 associated gene(s):
 +
*** [[Ec-14_006530]]
 +
*** [[Ec-17_000320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPROPIONATE-DEHYDROGENASE-RXN 3-HYDROXYPROPIONATE-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-15977 RXN-15977]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6384 RXN-6384]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}}
+
{{#set: taxonomic range=TAX-33208}}
{{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: molecular weight=1015.898    }}
+
{{#set: taxonomic range=TAX-33090}}
{{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}}
+
{{#set: common name=propanoyl-CoA degradation II}}
{{#set: consumed by=RXN-17781}}
+
{{#set: common name=propionyl-CoA degradation II}}
{{#set: produced by=RXN-17780}}
+
{{#set: reaction found=2}}
 +
{{#set: total reaction=5}}
 +
{{#set: completion rate=40.0}}

Latest revision as of 19:22, 21 March 2018

Pathway PWY-7574

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links