Difference between revisions of "PWY-5707"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14808 CPD-14808] == * smiles: ** C1(C(C(C(C(C1O)O)=O)O)O)O * inchi key: ** InChIKey=VYEGBDH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5707 PWY-5707] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40553 TAX-4...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5707 PWY-5707] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40553 TAX-40553] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** propanethial S-oxide biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** onion lachrymatory factor biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | == Reaction(s) | + | '''1''' reactions found over '''9''' reactions in the full pathway |
| − | == | + | * [[RXN-8899]] |
| − | * [[ | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16190 RXN-16190] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16191 RXN-16191] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16192 RXN-16192] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16193 RXN-16193] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8909 RXN-8909] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8910 RXN-8910] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8911 RXN-8911] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8912 RXN-8912] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-40553}} | |
| − | + | {{#set: common name=propanethial S-oxide biosynthesis}} | |
| − | + | {{#set: common name=onion lachrymatory factor biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=9}} |
| − | {{#set: | + | {{#set: completion rate=11.0}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:22, 21 March 2018
Pathway PWY-5707
- taxonomic range:
- common name:
- propanethial S-oxide biosynthesis
- Synonym(s):
- onion lachrymatory factor biosynthesis
Reaction(s) found
1 reactions found over 9 reactions in the full pathway
- RXN-8899
- 0 associated gene:
- 1 reconstruction source(s) associated:
