Difference between revisions of "CPD-68"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == * smiles: ** C([O-])(=O)C1(CC1)[N+] * inchi key: ** InChIKey=PAJPWUMXBYXFCZ-U...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == |
* smiles: | * smiles: | ||
| − | ** C(O) | + | ** C([O-])(=O)C1(CC1)[N+] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 1-aminocyclopropane-1-carboxylate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 101.105 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 1-aminocyclopropane-1-carboxylic acid |
| − | ** | + | ** ACC |
| − | ** | + | ** 1-aminocyclopropanecarboxylic acid |
| + | ** 1-aminocyclopropanecarboxylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[4.1.99.4-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4.4.1.14-RXN]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-15149]] |
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 22059-21-8 |
| − | + | ||
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971063 6971063] |
| − | * HMDB : | + | * HMDB : HMDB36458 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01234 C01234] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58360 58360] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC58360 |
| − | {{#set: smiles=C(O) | + | {{#set: smiles=C([O-])(=O)C1(CC1)[N+]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=1-aminocyclopropane-1-carboxylate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=101.105 }} |
| − | {{#set: common name= | + | {{#set: common name=1-aminocyclopropane-1-carboxylic acid|ACC|1-aminocyclopropanecarboxylic acid|1-aminocyclopropanecarboxylate}} |
| − | {{#set: | + | {{#set: consumed by=4.1.99.4-RXN}} |
| − | {{#set: reversible reaction associated= | + | {{#set: produced by=4.4.1.14-RXN}} |
| + | {{#set: reversible reaction associated=RXN-15149}} | ||
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite CPD-68
- smiles:
- C([O-])(=O)C1(CC1)[N+]
- inchi key:
- InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N
- common name:
- 1-aminocyclopropane-1-carboxylate
- molecular weight:
- 101.105
- Synonym(s):
- 1-aminocyclopropane-1-carboxylic acid
- ACC
- 1-aminocyclopropanecarboxylic acid
- 1-aminocyclopropanecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 22059-21-8
- PUBCHEM:
- HMDB : HMDB36458
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58360
"C([O-])(=O)C1(CC1)[N+" cannot be used as a page name in this wiki.
