Difference between revisions of "Ec-06 008640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] == * smiles: ** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O...")
(Created page with "Category:Gene == Gene Ec-06_008640 == * left end position: ** 6312407 * transcription direction: ** POSITIVE * right end position: ** 6317573 * centisome position: ** 72.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+
== Gene Ec-06_008640 ==
−
* smiles:
+
* left end position:
−
** CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)
+
** 6312407
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** GDP-β-L-fucose
+
** 6317573
−
* molecular weight:
+
* centisome position:
−
** 587.33    
+
** 72.07789    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0252_0001
 +
** Esi0252_0001
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[1.1.1.271-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
−
* [[2.4.1.221-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6312407}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244478 25244478]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=6317573}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57273 57273]
+
{{#set: centisome position=72.07789   }}
−
{{#set: smiles=CC4(OC(OP(OP(OCC3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))([O-])=O)([O-])=O)C(C(C4O)O)O)}}
+
{{#set: common name=Esi_0252_0001|Esi0252_0001}}
−
{{#set: inchi key=InChIKey=LQEBEXMHBLQMDB-JGQUBWHWSA-L}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: common name=GDP-β-L-fucose}}
+
−
{{#set: molecular weight=587.33   }}
+
−
{{#set: produced by=1.1.1.271-RXN}}
+
−
{{#set: reversible reaction associated=2.4.1.221-RXN}}
+

Latest revision as of 19:22, 21 March 2018

Gene Ec-06_008640

  • left end position:
    • 6312407
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6317573
  • centisome position:
    • 72.07789
  • Synonym(s):
    • Esi_0252_0001
    • Esi0252_0001

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_008640&oldid=26463"