Difference between revisions of "Ec-14 004310"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Gene == Gene Ec-14_004310 == * left end position: ** 4036157 * transcription direction: ** NEGATIVE * right end position: ** 4050185 * centisome position: ** 61.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] ==
+
== Gene Ec-14_004310 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4036157
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
+
** 4050185
−
* molecular weight:
+
* centisome position:
−
** 1015.898    
+
** 61.52277    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-16:1-Δ7-CoA
+
** Esi_0099_0059
−
** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
+
** Esi0099_0059
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17781]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17780]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=4036157}}
−
{{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=4050185}}
−
{{#set: molecular weight=1015.898   }}
+
{{#set: centisome position=61.52277   }}
−
{{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}}
+
{{#set: common name=Esi_0099_0059|Esi0099_0059}}
−
{{#set: consumed by=RXN-17781}}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: produced by=RXN-17780}}
+

Latest revision as of 20:22, 21 March 2018

Gene Ec-14_004310

  • left end position:
    • 4036157
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4050185
  • centisome position:
    • 61.52277
  • Synonym(s):
    • Esi_0099_0059
    • Esi0099_0059

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_004310&oldid=26473"