Difference between revisions of "GLYCOLATE-REDUCTASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJR...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATE-REDUCTASE-RXN GLYCOLATE-REDUCTASE-RXN] == * direction: ** REVERSIBLE * ec number: ** [htt...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLATE-REDUCTASE-RXN GLYCOLATE-REDUCTASE-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.26 EC-1.1.1.26] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[NAD]][c] '''+''' 1 [[GLYCOLLATE]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[GLYOX]][c] '''+''' 1 [[PROTON]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 NAD+[c] '''+''' 1 glycolate[c] '''<=>''' 1 NADH[c] '''+''' 1 glyoxylate[c] '''+''' 1 H+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-7295]], L-arabinose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295] | ||
+ | ** '''3''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-7294]], xylose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7294 PWY-7294] | ||
+ | ** '''3''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[gap-filling]] | ||
+ | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | *** Tool: [[meneco]] | ||
+ | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18229 18229] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00717 R00717] | |
− | * LIGAND- | + | {{#set: direction=REVERSIBLE}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.1.1.26}} |
− | + | {{#set: in pathway=PWY-7295|PWY-7294}} | |
− | + | {{#set: reconstruction category=gap-filling}} | |
− | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} | |
− | {{#set: | + | {{#set: reconstruction tool=meneco}} |
− | {{#set: | + | {{#set: reconstruction comment=added for gapfilling}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:22, 21 March 2018
Contents
Reaction GLYCOLATE-REDUCTASE-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 GLYCOLLATE[c] <=> 1 NADH[c] + 1 GLYOX[c] + 1 PROTON[c]
- With common name(s):
- 1 NAD+[c] + 1 glycolate[c] <=> 1 NADH[c] + 1 glyoxylate[c] + 1 H+[c]
Genes associated with this reaction
Pathways
- PWY-7295, L-arabinose degradation IV: PWY-7295
- 3 reactions found over 8 reactions in the full pathway
- PWY-7294, xylose degradation IV: PWY-7294
- 3 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
External links