Difference between revisions of "CENTFERM-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CENTFERM-PWY CENTFERM-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-122...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CENTFERM-PWY CENTFERM-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** pyruvate fermentation to butanoate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** central fermentation pathway |
− | ** | + | ** acetobutylicum fermentation |
+ | ** pyruvate fermentation to butyrate | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''7''' reactions in the full pathway |
− | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] | |
− | == Reaction(s) | + | ** 3 associated gene(s): |
+ | *** [[Ec-26_003940]] | ||
+ | *** [[Ec-24_000870]] | ||
+ | *** [[Ec-22_002850]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PYRUFLAVREDUCT-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-18_003420]] | ||
+ | *** [[Ec-15_004230]] | ||
+ | *** [[Ec-23_002710]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-11662]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-19_005290]] | ||
+ | *** [[Ec-14_006530]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN-11667]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Ec-17_000320]] | ||
+ | *** [[Ec-14_006530]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=BUTYRATE-KINASE-RXN BUTYRATE-KINASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHATE-BUTYRYLTRANSFERASE-RXN PHOSPHATE-BUTYRYLTRANSFERASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=pyruvate fermentation to butanoate}} | |
− | + | {{#set: common name=central fermentation pathway|acetobutylicum fermentation|pyruvate fermentation to butyrate}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=57.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:23, 21 March 2018
Pathway CENTFERM-PWY
- taxonomic range:
- common name:
- pyruvate fermentation to butanoate
- Synonym(s):
- central fermentation pathway
- acetobutylicum fermentation
- pyruvate fermentation to butyrate
Reaction(s) found
4 reactions found over 7 reactions in the full pathway
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- PYRUFLAVREDUCT-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11662
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-11667
- 2 associated gene(s):
- 2 reconstruction source(s) associated: