Difference between revisions of "CPD-4143"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Plastocyanin-Reduced Plastocyanin-Reduced] == * common name: ** a reduced plastocyanin * Synony...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4143 CPD-4143] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4143 CPD-4143] == |
| + | * smiles: | ||
| + | ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=KZJWDPNRJALLNS-VJSFXXLFSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** sitosterol |
| + | * molecular weight: | ||
| + | ** 414.713 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** β-sitosterol | ||
| + | ** quebrachol | ||
| + | ** cinchol | ||
| + | ** cupreol | ||
| + | ** rhamnol | ||
| + | ** 22,23-dihydrostigmasterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12789]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIPID_MAPS : LMST01040129 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=222284 222284] | ||
| + | * HMDB : HMDB00852 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01753 C01753] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.192962.html 192962] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27693 27693] | ||
| + | * METABOLIGHTS : MTBLC27693 | ||
| + | {{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=KZJWDPNRJALLNS-VJSFXXLFSA-N}} | ||
| + | {{#set: common name=sitosterol}} | ||
| + | {{#set: molecular weight=414.713 }} | ||
| + | {{#set: common name=β-sitosterol|quebrachol|cinchol|cupreol|rhamnol|22,23-dihydrostigmasterol}} | ||
| + | {{#set: consumed by=RXN-12789}} | ||
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CPD-4143
- smiles:
- CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=KZJWDPNRJALLNS-VJSFXXLFSA-N
- common name:
- sitosterol
- molecular weight:
- 414.713
- Synonym(s):
- β-sitosterol
- quebrachol
- cinchol
- cupreol
- rhamnol
- 22,23-dihydrostigmasterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMST01040129
- PUBCHEM:
- HMDB : HMDB00852
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC27693
"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
