Difference between revisions of "Ec-23 001510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * i...") |
(Created page with "Category:Gene == Gene Ec-23_001510 == * left end position: ** 1537688 * transcription direction: ** NEGATIVE * right end position: ** 1540331 * centisome position: ** 31.7...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_001510 == |
− | * | + | * left end position: |
− | ** | + | ** 1537688 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1540331 |
− | * | + | * centisome position: |
− | ** | + | ** 31.773912 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0042_0143 |
− | ** | + | ** Esi0042_0143 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[1.14.11.2-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1537688}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1540331}} | |
− | + | {{#set: centisome position=31.773912 }} | |
− | + | {{#set: common name=Esi_0042_0143|Esi0042_0143}} | |
− | + | {{#set: reaction associated=1.14.11.2-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:23, 21 March 2018
Gene Ec-23_001510
- left end position:
- 1537688
- transcription direction:
- NEGATIVE
- right end position:
- 1540331
- centisome position:
- 31.773912
- Synonym(s):
- Esi_0042_0143
- Esi0042_0143
Reactions associated
- Reaction: 1.14.11.2-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome