Difference between revisions of "Ec-21 002300"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] == * smiles: ** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Gene == Gene Ec-21_002300 == * left end position: ** 3325345 * transcription direction: ** NEGATIVE * right end position: ** 3326962 * centisome position: ** 45.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19168 CPD-19168] ==
+
== Gene Ec-21_002300 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3325345
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(7Z)-hexadecenoyl-CoA
+
** 3326962
−
* molecular weight:
+
* centisome position:
−
** 1015.898    
+
** 45.058147    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-16:1-Δ7-CoA
+
** Esi_0150_0029
−
** (S)-3-hydroxy-7-cis-hexadecenoyl-CoA
+
** Esi0150_0029
 +
** OGDC
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17781]]
+
* Reaction: [[2OXOGLUTARATEDEH-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17780]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[2OXOGLUTDECARB-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7716]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN0-1147]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7254]]
 +
* [[TCA]]
 +
* [[PWY-5084]]
 +
* [[PWY66-398]]
 +
* [[PWY-5690]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=3325345}}
−
{{#set: inchi key=InChIKey=KZLHPKRIEDLQGG-SQUPIXLDSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(S)-3-hydroxy-(7Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=3326962}}
−
{{#set: molecular weight=1015.898   }}
+
{{#set: centisome position=45.058147   }}
−
{{#set: common name=(S)-3-hydroxy-16:1-Δ7-CoA|(S)-3-hydroxy-7-cis-hexadecenoyl-CoA}}
+
{{#set: common name=Esi_0150_0029|Esi0150_0029|OGDC}}
−
{{#set: consumed by=RXN-17781}}
+
{{#set: reaction associated=2OXOGLUTARATEDEH-RXN|2OXOGLUTDECARB-RXN|RXN-7716|RXN0-1147}}
−
{{#set: produced by=RXN-17780}}
+
{{#set: pathway associated=PWY-7254|TCA|PWY-5084|PWY66-398|PWY-5690}}

Latest revision as of 19:23, 21 March 2018

Gene Ec-21_002300

  • left end position:
    • 3325345
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3326962
  • centisome position:
    • 45.058147
  • Synonym(s):
    • Esi_0150_0029
    • Esi0150_0029
    • OGDC

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_002300&oldid=26562"