Difference between revisions of "CPD-8609"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] == * direction: ** LEFT-TO-RIGHT * common name: ** Fatty acid hydroxylase * ec...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-218 RXN3O-218] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
 +
* inchi key:
 +
** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
 
* common name:
 
* common name:
−
** Fatty acid hydroxylase
+
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
+
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-14]]
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[EPISTEROL]][c] '''+''' 2 [[PROTON]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[CPD-700]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-13]]
−
** 1 oxygen[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 episterol[c] '''+''' 2 H+[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] '''+''' 1 ergosta-5,7,24(28)-trien-3β-ol[c]
+
* [[RXN-13707]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-01_003780]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
+
−
** '''10''' reactions found over '''36''' reactions in the full pathway
+
−
* [[PWY-6075]], ergosterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6075 PWY-6075]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33463 33463]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200473 25200473]
−
* LIGAND-RXN:
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R07505 R07505]
+
{{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R07491 R07491]
+
{{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: common name=Fatty acid hydroxylase}}
+
{{#set: consumed by=RXN66-14}}
−
{{#set: ec number=EC-1.14.19.20}}
+
{{#set: produced by=RXN66-13|RXN-13707}}
−
{{#set: gene associated=Ec-01_003780}}
+
−
{{#set: in pathway=PWY-2541|PWY-6075}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:23, 21 March 2018

Metabolite CPD-8609

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
  • inchi key:
    • InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
  • common name:
    • 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-8609&oldid=26591"