Difference between revisions of "PWY-6897"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
+
 
* common name:
 
* common name:
** (2E,7Z)-tetradecenoyl-CoA
+
** thiamine salvage II
* molecular weight:
+
** 969.83   
+
 
* Synonym(s):
 
* Synonym(s):
** 14:2-Δ2,Δ7-CoA
+
** thiamin salvage II
** 2-trans,7-cis-tetradecenoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17793]]
+
'''3''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PWY-6910]]
* [[RXN-17792]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
* [[THI-P-SYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-06_006870]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[THIAZOLSYN3-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_008860]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=THI-P-KIN-RXN THI-P-KIN-RXN]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ECOCYC:
{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6897 PWY-6897]
{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: molecular weight=969.83    }}
+
{{#set: common name=thiamine salvage II}}
{{#set: common name=14:2-Δ2,Δ7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
+
{{#set: common name=thiamin salvage II}}
{{#set: consumed by=RXN-17793}}
+
{{#set: reaction found=3}}
{{#set: produced by=RXN-17792}}
+
{{#set: total reaction=5}}
 +
{{#set: completion rate=60.0}}

Latest revision as of 19:23, 21 March 2018

Pathway PWY-6897

  • taxonomic range:
  • common name:
    • thiamine salvage II
  • Synonym(s):
    • thiamin salvage II

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links