Difference between revisions of "PWY-7767"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] == * smiles: ** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7767 PWY-7767] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-120 CPD1G-120] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7767 PWY-7767] ==
* smiles:
+
* taxonomic range:
** C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O
+
 
* common name:
 
* common name:
** deacetylmycothiol
+
** leucine degradation IV
* molecular weight:
+
** 445.461   
+
 
* Synonym(s):
 
* Synonym(s):
** 1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside
 
** Cys-GlcN-Ins
 
** 3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol
 
** desacetylmycothiol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''5''' reactions in the full pathway
* [[RXN1G-121]]
+
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-12_005560]]
 +
*** [[Ec-20_001390]]
 +
*** [[Ec-12_005530]]
 +
*** [[Ec-12_005520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16245 RXN-16245]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16246 RXN-16246]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16247 RXN-16247]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17524 RXN-17524]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878469 46878469]
+
{{#set: common name=leucine degradation IV}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58887 58887]
+
{{#set: total reaction=5}}
{{#set: smiles=C(O)C2(C(C(C(NC(=O)C([N+])CS)C(OC1(C(O)C(O)C(O)C(O)C(O)1))O2)O)O)}}
+
{{#set: completion rate=20.0}}
{{#set: inchi key=InChIKey=ZGXSCMBZZVXWGF-BSEFFJTHSA-O}}
+
{{#set: common name=deacetylmycothiol}}
+
{{#set: molecular weight=445.461    }}
+
{{#set: common name=1-D-myo-inosityl-2-(L-cysteinyl)amido-2-deoxy-α-D-glucopyranoside|Cys-GlcN-Ins|3-O-(2-L-cysteinamido-2-deoxy-alpha-D-glucopyranosyl)-1D-myo-inositol|desacetylmycothiol}}
+
{{#set: produced by=RXN1G-121}}
+

Latest revision as of 19:23, 21 March 2018

Pathway PWY-7767

  • taxonomic range:
  • common name:
    • leucine degradation IV
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links