Difference between revisions of "CPD0-2189"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.3-RXN 1.3.7.3-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Ferredoxin-dependent bi...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=JBNUARFQ...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.3-RXN 1.3.7.3-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C(O)C([N+])C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
 
* common name:
 
* common name:
−
** Ferredoxin-dependent bilin reductase
+
** 4-hydroxy-L-threonine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.7.3 EC-1.3.7.3]
+
** 135.119   
 
* Synonym(s):
 
* Synonym(s):
 +
** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
 +
** hydroxythreonine
 +
** 3-hydroxyhomoserine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[1516-DIHYDROBILIVERDIN]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[3Z-PHYCOERYTHROBILIN]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
+
* [[RXN-14125]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 15,16-dihydrobiliverdin[c] '''+''' 2 H+[c] '''=>''' 1 (3Z)-phycoerythrobilin[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-22_000060]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7579]], phycourobilin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7579 PWY-7579]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-5915]], phycoerythrobilin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5915 PWY-5915]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* CAS : 21768-45-6
−
** [http://www.genome.jp/dbget-bin/www_bget?R05819 R05819]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420]
−
{{#set: common name=Ferredoxin-dependent bilin reductase}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.3.7.3}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056]
−
{{#set: gene associated=Ec-22_000060}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-7579|PWY-5915}}
+
** [http://www.chemspider.com/Chemical-Structure.167988.html 167988]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904]
−
{{#set: reconstruction source=esiliculosus_genome}}
+
* BIGG : 1450010
 +
{{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}}
 +
{{#set: common name=4-hydroxy-L-threonine}}
 +
{{#set: molecular weight=135.119    }}
 +
{{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}}
 +
{{#set: produced by=RXN-14125}}

Latest revision as of 20:24, 21 March 2018

Metabolite CPD0-2189

  • smiles:
    • C(O)C(O)C([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
  • common name:
    • 4-hydroxy-L-threonine
  • molecular weight:
    • 135.119
  • Synonym(s):
    • (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
    • hydroxythreonine
    • 3-hydroxyhomoserine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-2189&oldid=26623"