Difference between revisions of "Ec-01 000360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3O)O)O) * i...") |
(Created page with "Category:Gene == Gene Ec-01_000360 == * left end position: ** 265914 * transcription direction: ** NEGATIVE * right end position: ** 271273 * centisome position: ** 2.5769...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_000360 == |
− | * | + | * left end position: |
− | ** | + | ** 265914 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 271273 |
− | * | + | * centisome position: |
− | ** | + | ** 2.5769773 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0207_0060 |
− | ** | + | ** Esi0207_0060 |
+ | ** UROD1 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-10642]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[UROGENDECARBOX-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[HEMESYN2-PWY]] | ||
+ | * [[PWY0-1415]] | ||
+ | * [[PWY-7159]] | ||
+ | * [[PWY-7766]] | ||
+ | * [[CHLOROPHYLL-SYN]] | ||
+ | * [[HEME-BIOSYNTHESIS-II]] | ||
+ | * [[PWY-5531]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=265914}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=271273}} | |
− | + | {{#set: centisome position=2.5769773 }} | |
− | + | {{#set: common name=Esi_0207_0060|Esi0207_0060|UROD1}} | |
− | + | {{#set: reaction associated=RXN-10642|UROGENDECARBOX-RXN}} | |
− | + | {{#set: pathway associated=HEMESYN2-PWY|PWY0-1415|PWY-7159|PWY-7766|CHLOROPHYLL-SYN|HEME-BIOSYNTHESIS-II|PWY-5531}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:24, 21 March 2018
Gene Ec-01_000360
- left end position:
- 265914
- transcription direction:
- NEGATIVE
- right end position:
- 271273
- centisome position:
- 2.5769773
- Synonym(s):
- Esi_0207_0060
- Esi0207_0060
- UROD1
Reactions associated
- Reaction: RXN-10642
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: UROGENDECARBOX-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome