Difference between revisions of "PWY-5691"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5691 PWY-5691] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5691 PWY-5691] == |
| − | * | + | * taxonomic range: |
| − | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** urate degradation to allantoin I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
| − | * | + | * [[3.5.2.17-RXN]] |
| − | + | ** 0 associated gene: | |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-esiliculosus_genome]] |
| − | * | + | * [[RXN-6201]] |
| − | + | ** 0 associated gene: | |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-esiliculosus_genome]] |
| − | * | + | * [[URATE-OXIDASE-RXN]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * | + | *** [[Ec-06_002470]] |
| − | * [[ | + | ** 2 reconstruction source(s) associated: |
| − | * [[ | + | *** [[annotation-esiliculosus_genome]] |
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=urate degradation to allantoin I}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:24, 21 March 2018
Pathway PWY-5691
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- 3.5.2.17-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-6201
- 0 associated gene:
- 1 reconstruction source(s) associated:
- URATE-OXIDASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
