Difference between revisions of "RXN-14281"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] == * smiles: ** CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14281 RXN-14281] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucosidase 2 subunit beta...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14281 RXN-14281] ==
−
* smiles:
+
* direction:
−
** CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KFWWCMJSYSSPSK-BOGFJHSMSA-J
+
 
* common name:
 
* common name:
−
** crotonyl-CoA
+
** Glucosidase 2 subunit beta
−
* molecular weight:
+
** Glucosidase II beta subunit, N-terminal
−
** 831.577   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.2.1.20 EC-3.2.1.20]
 
* Synonym(s):
 
* Synonym(s):
−
** crotonyl-S-CoA
 
−
** crotonyl-coenzyme A
 
−
** crotonoyl-CoA
 
−
** 2-butenoyl-CoA
 
−
** trans-but-2-enoyl-CoA
 
−
** but-2-enoyl-CoA
 
−
** trans-butyr-2-enoyl-CoA
 
−
** (E)-but-2-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[MALTOPENTAOSE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[MALTOTETRAOSE]][c]
−
* [[RXN-11667]]
+
* With common name(s):
 +
** 1 maltopentaose[c] '''+''' 1 H2O[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 maltotetraose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_006760]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-23_001860]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* UM-BBD-CPD : c0032
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CAS : 102680-35-3
+
{{#set: common name=Glucosidase 2 subunit beta}}
−
* BIGG : 36265
+
{{#set: common name=Glucosidase II beta subunit, N-terminal}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.2.1.20}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245057 25245057]
+
{{#set: gene associated=Ec-01_006760|Ec-23_001860}}
−
* HMDB : HMDB02009
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00877 C00877]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57332 57332]
+
−
* METABOLIGHTS : MTBLC57332
+
−
{{#set: smiles=CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O}}
+
−
{{#set: inchi key=InChIKey=KFWWCMJSYSSPSK-BOGFJHSMSA-J}}
+
−
{{#set: common name=crotonyl-CoA}}
+
−
{{#set: molecular weight=831.577    }}
+
−
{{#set: common name=crotonyl-S-CoA|crotonyl-coenzyme A|crotonoyl-CoA|2-butenoyl-CoA|trans-but-2-enoyl-CoA|but-2-enoyl-CoA|trans-butyr-2-enoyl-CoA|(E)-but-2-enoyl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-11667}}
+

Latest revision as of 19:24, 21 March 2018

Reaction RXN-14281

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glucosidase 2 subunit beta
    • Glucosidase II beta subunit, N-terminal
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14281&oldid=26634"