Difference between revisions of "CPD-10546"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxybehenoyl-ACPs R-3-hydroxybehenoyl-ACPs] == * common name: ** a (3R)-3-hydroxybehenoy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == * smiles: ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) * inchi key: ** InChIKey=K...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10546 CPD-10546] == |
+ | * smiles: | ||
+ | ** C1(NC2(C(C=1CC(=O)OC)=CC=CC=2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=KTHADMDGDNYQRX-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** methyl (indol-3-yl)acetate |
+ | * molecular weight: | ||
+ | ** 189.213 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** IAA methyl ester | ||
+ | ** methyl IAA | ||
+ | ** MeIAA | ||
+ | ** indole-3-acetic acid methyl ester | ||
+ | ** methyl 2-(1H-indol-3-yl)acetate | ||
+ | ** methyl indole-3-acetate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10711]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=74706 74706] |
− | {{#set: | + | * KNAPSACK : C00000101 |
+ | * HMDB : HMDB29738 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C20635 C20635] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.67279.html 67279] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72782 72782] | ||
+ | * METABOLIGHTS : MTBLC72782 | ||
+ | {{#set: smiles=C1(NC2(C(C=1CC(=O)OC)=CC=CC=2))}} | ||
+ | {{#set: inchi key=InChIKey=KTHADMDGDNYQRX-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=methyl (indol-3-yl)acetate}} | ||
+ | {{#set: molecular weight=189.213 }} | ||
+ | {{#set: common name=IAA methyl ester|methyl IAA|MeIAA|indole-3-acetic acid methyl ester|methyl 2-(1H-indol-3-yl)acetate|methyl indole-3-acetate}} | ||
+ | {{#set: consumed by=RXN-10711}} |
Latest revision as of 19:24, 21 March 2018
Contents
Metabolite CPD-10546
- smiles:
- C1(NC2(C(C=1CC(=O)OC)=CC=CC=2))
- inchi key:
- InChIKey=KTHADMDGDNYQRX-UHFFFAOYSA-N
- common name:
- methyl (indol-3-yl)acetate
- molecular weight:
- 189.213
- Synonym(s):
- IAA methyl ester
- methyl IAA
- MeIAA
- indole-3-acetic acid methyl ester
- methyl 2-(1H-indol-3-yl)acetate
- methyl indole-3-acetate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00000101
- HMDB : HMDB29738
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC72782