Difference between revisions of "5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANYLCYC-RXN GUANYLCYC-RXN] == * direction: ** REVERSIBLE * common name: ** Adenylyl cyclase class...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE] == * smiles: ** C2([N+]=CN...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE] == |
− | * | + | * smiles: |
− | ** | + | ** C2([N+]=CN(C1(OC(COP([O-])(=O)[O-])C(O)C(O)1))C(N)=2) |
+ | * inchi key: | ||
+ | ** InChIKey=PDACUKOKVHBVHJ-XVFCMESISA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 5-amino-1-(5-phospho-β-D-ribosyl)imidazole |
− | * | + | * molecular weight: |
− | + | ** 294.18 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-aminoimidazole ribonucleotide | ||
+ | ** 5-amino-1-(5-phospho-D-ribosyl)imidazole | ||
+ | ** 5-aminoimidazole ribotide | ||
+ | ** AIR | ||
+ | ** 1-(5'-phosphoribosyl)-5-aminoimidazole | ||
+ | ** 5'-phosphoribosyl-5-aminoimidazole | ||
+ | ** phosphoribosylaminoimidazole | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[AIRCARBOXY-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 25635-88-5 |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229244 44229244] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB01235 |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03373 C03373] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28843 28843] | |
− | * | + | * BIGG : 41727 |
− | + | {{#set: smiles=C2([N+]=CN(C1(OC(COP([O-])(=O)[O-])C(O)C(O)1))C(N)=2)}} | |
− | + | {{#set: inchi key=InChIKey=PDACUKOKVHBVHJ-XVFCMESISA-M}} | |
− | + | {{#set: common name=5-amino-1-(5-phospho-β-D-ribosyl)imidazole}} | |
− | + | {{#set: molecular weight=294.18 }} | |
− | + | {{#set: common name=5-aminoimidazole ribonucleotide|5-amino-1-(5-phospho-D-ribosyl)imidazole|5-aminoimidazole ribotide|AIR|1-(5'-phosphoribosyl)-5-aminoimidazole|5'-phosphoribosyl-5-aminoimidazole|phosphoribosylaminoimidazole}} | |
− | + | {{#set: consumed by=AIRCARBOXY-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE
- smiles:
- C2([N+]=CN(C1(OC(COP([O-])(=O)[O-])C(O)C(O)1))C(N)=2)
- inchi key:
- InChIKey=PDACUKOKVHBVHJ-XVFCMESISA-M
- common name:
- 5-amino-1-(5-phospho-β-D-ribosyl)imidazole
- molecular weight:
- 294.18
- Synonym(s):
- 5-aminoimidazole ribonucleotide
- 5-amino-1-(5-phospho-D-ribosyl)imidazole
- 5-aminoimidazole ribotide
- AIR
- 1-(5'-phosphoribosyl)-5-aminoimidazole
- 5'-phosphoribosyl-5-aminoimidazole
- phosphoribosylaminoimidazole
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2([N+]=CN(C1(OC(COP([O-])(=O)[O-])C(O)C(O)1))C(N)=2)" cannot be used as a page name in this wiki.