Difference between revisions of "RXN-16759"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16759 RXN-16759] == * direction: ** REVERSIBLE * common name: ** holo-[acyl-carrier-protein] sy...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16759 RXN-16759] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** holo-[acyl-carrier-protein] synthase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[CO-A]][c] '''+''' 1 [[LYS2-peptidyl-carrier-protein]][c] '''<=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[Holo-LYS2-peptidyl-carrier-protein]][c] '''+''' 1 [[PROTON]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 coenzyme A[c] '''+''' 1 an apo-[LYS2 peptidyl-carrier-protein][c] '''<=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a holo-[LYS2 peptidyl-carrier-protein][c] '''+''' 1 H+[c] | |
| − | + | ||
| − | * [[1 | + | == Genes associated with this reaction == |
| − | == | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Ec-01_000130]] |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| − | * [[ | + | *** Assignment: GO-TERM |
| − | * [[ | + | * Gene: [[Ec-06_004620]] |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| − | * [[ | + | *** Assignment: GO-TERM |
| − | * [[ | + | == Pathways == |
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=holo-[acyl-carrier-protein] synthase}} | |
| − | + | {{#set: ec number=EC-2.7.8.7}} | |
| − | + | {{#set: gene associated=Ec-01_000130|Ec-06_004620}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:24, 21 March 2018
Contents
Reaction RXN-16759
- direction:
- REVERSIBLE
- common name:
- holo-[acyl-carrier-protein] synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CO-A[c] + 1 LYS2-peptidyl-carrier-protein[c] <=> 1 3-5-ADP[c] + 1 Holo-LYS2-peptidyl-carrier-protein[c] + 1 PROTON[c]
- With common name(s):
- 1 coenzyme A[c] + 1 an apo-[LYS2 peptidyl-carrier-protein][c] <=> 1 adenosine 3',5'-bisphosphate[c] + 1 a holo-[LYS2 peptidyl-carrier-protein][c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-01_000130
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_004620
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
"holo-[acyl-carrier-protein] synthase" cannot be used as a page name in this wiki.
