Difference between revisions of "Ec-09 000640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * smiles: ** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Gene == Gene Ec-09_000640 == * left end position: ** 827832 * transcription direction: ** NEGATIVE * right end position: ** 850282 * centisome position: ** 14.748...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+
== Gene Ec-09_000640 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 827832
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (2E,7Z)-tetradecenoyl-CoA
+
** 850282
−
* molecular weight:
+
* centisome position:
−
** 969.83    
+
** 14.748054    
 
* Synonym(s):
 
* Synonym(s):
−
** 14:2-Δ2,Δ7-CoA
+
** Esi_0146_0024
−
** 2-trans,7-cis-tetradecenoyl-CoA
+
** Esi0146_0024
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17793]]
+
* Reaction: [[GLUTAMINESYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17792]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[GLNSYN-PWY]]
 +
* [[PWY-5675]]
 +
* [[PWY-381]]
 +
* [[PWY-6549]]
 +
* [[PWY-6964]]
 +
* [[PWY-6963]]
 +
* [[PWY490-3]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=827832}}
−
{{#set: inchi key=InChIKey=MWKSUVQQMPJTPP-DTPVMWFYSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(2E,7Z)-tetradecenoyl-CoA}}
+
{{#set: right end position=850282}}
−
{{#set: molecular weight=969.83   }}
+
{{#set: centisome position=14.748054   }}
−
{{#set: common name=14:2-Δ2,Δ7-CoA|2-trans,7-cis-tetradecenoyl-CoA}}
+
{{#set: common name=Esi_0146_0024|Esi0146_0024}}
−
{{#set: consumed by=RXN-17793}}
+
{{#set: reaction associated=GLUTAMINESYN-RXN}}
−
{{#set: produced by=RXN-17792}}
+
{{#set: pathway associated=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY-6963|PWY490-3}}

Latest revision as of 20:24, 21 March 2018

Gene Ec-09_000640

  • left end position:
    • 827832
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 850282
  • centisome position:
    • 14.748054
  • Synonym(s):
    • Esi_0146_0024
    • Esi0146_0024

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_000640&oldid=26718"