Difference between revisions of "L-fucose-protein-serine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] == * smiles: ** CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-fucose-protein-serine L-fucose-protein-serine] == * common name: ** a [protein]-3-O-L-fucosyl...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-fucose-protein-serine L-fucose-protein-serine] ==
* smiles:
+
** CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O
+
* inchi key:
+
** InChIKey=KFWWCMJSYSSPSK-BOGFJHSMSA-J
+
 
* common name:
 
* common name:
** crotonyl-CoA
+
** a [protein]-3-O-L-fucosyl-L-serine
* molecular weight:
+
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
** crotonyl-S-CoA
+
** a [protein] L-serine-L-fucose
** crotonyl-coenzyme A
+
** crotonoyl-CoA
+
** 2-butenoyl-CoA
+
** trans-but-2-enoyl-CoA
+
** but-2-enoyl-CoA
+
** trans-butyr-2-enoyl-CoA
+
** (E)-but-2-enoyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-11667]]
+
* [[2.4.1.221-RXN]]
 
== External links  ==
 
== External links  ==
* UM-BBD-CPD : c0032
+
{{#set: common name=a [protein]-3-O-L-fucosyl-L-serine}}
* CAS : 102680-35-3
+
{{#set: common name=a [protein] L-serine-L-fucose}}
* BIGG : 36265
+
{{#set: reversible reaction associated=2.4.1.221-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245057 25245057]
+
* HMDB : HMDB02009
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00877 C00877]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57332 57332]
+
* METABOLIGHTS : MTBLC57332
+
{{#set: smiles=CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O}}
+
{{#set: inchi key=InChIKey=KFWWCMJSYSSPSK-BOGFJHSMSA-J}}
+
{{#set: common name=crotonyl-CoA}}
+
{{#set: molecular weight=831.577    }}
+
{{#set: common name=crotonyl-S-CoA|crotonyl-coenzyme A|crotonoyl-CoA|2-butenoyl-CoA|trans-but-2-enoyl-CoA|but-2-enoyl-CoA|trans-butyr-2-enoyl-CoA|(E)-but-2-enoyl-CoA}}
+
{{#set: reversible reaction associated=RXN-11667}}
+

Latest revision as of 19:25, 21 March 2018

Metabolite L-fucose-protein-serine

  • common name:
    • a [protein]-3-O-L-fucosyl-L-serine
  • Synonym(s):
    • a [protein] L-serine-L-fucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-3-O-L-fucosyl-L-serine" cannot be used as a page name in this wiki.
"a [protein] L-serine-L-fucose" cannot be used as a page name in this wiki.