Difference between revisions of "PWY-5751"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5751 PWY-5751] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5751 PWY-5751] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-131567 TAX-131567] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** phenylethanol biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** phenyacetaldehyde biosynthesis |
+ | ** phenylacetaldehyde and phenylethanol biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''1''' reactions found over '''8''' reactions in the full pathway |
− | == | + | * [[AMINEPHEN-RXN]] |
− | * [[RXN- | + | ** 2 associated gene(s): |
+ | *** [[Ec-15_002920]] | ||
+ | *** [[Ec-15_002910]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PHENYLALANINE-DECARBOXYLASE-RXN PHENYLALANINE-DECARBOXYLASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12065 RXN-12065] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13536 RXN-13536] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13537 RXN-13537] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4602 RXN-4602] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7700 RXN-7700] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8990 RXN-8990] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-131567}} | |
− | + | {{#set: common name=phenylethanol biosynthesis}} | |
− | + | {{#set: common name=phenyacetaldehyde biosynthesis|phenylacetaldehyde and phenylethanol biosynthesis}} | |
− | {{#set: | + | {{#set: reaction found=1}} |
− | {{#set: | + | {{#set: total reaction=8}} |
− | {{#set: common name= | + | {{#set: completion rate=13.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:25, 21 March 2018
Pathway PWY-5751
- taxonomic range:
- common name:
- phenylethanol biosynthesis
- Synonym(s):
- phenyacetaldehyde biosynthesis
- phenylacetaldehyde and phenylethanol biosynthesis
Reaction(s) found
1 reactions found over 8 reactions in the full pathway
- AMINEPHEN-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: