Difference between revisions of "CPD-15530"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6502 PWY-6502] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6502 PWY-6502] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15530 CPD-15530] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
+
** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
 
* common name:
 
* common name:
−
** oxidized GTP and dGTP detoxification
+
** aldehydo-D-glucuronate
 +
* molecular weight:
 +
** 193.133   
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-(d)GTP detoxification
+
** aldehydo-D-glucuronic acid
−
** oxidized guanosine triphosphate and deoxyguanosine triphosphate detoxification
+
−
** 8-oxo-7,8-dihydro-guanosine-triphosphate and 8-oxo-7,8-dihydro-deoxyguanosine-triphosphate
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-11409]]
+
== Reaction(s) of unknown directionality ==
−
** 0 associated gene:
+
* [[RXN-14693]]
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-11410]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11396 RXN-11396]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11397 RXN-11397]
+
 
== External links  ==
 
== External links  ==
−
* PLANTCYC : PWY-6502
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-33154}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460126 5460126]
−
{{#set: taxonomic range=TAX-33090}}
+
* CHEBI:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47953 47953]
−
{{#set: common name=oxidized GTP and dGTP detoxification}}
+
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
−
{{#set: common name=8-oxo-(d)GTP detoxification|oxidized guanosine triphosphate and deoxyguanosine triphosphate detoxification|8-oxo-7,8-dihydro-guanosine-triphosphate and 8-oxo-7,8-dihydro-deoxyguanosine-triphosphate}}
+
{{#set: inchi key=InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M}}
−
{{#set: reaction found=2}}
+
{{#set: common name=aldehydo-D-glucuronate}}
−
{{#set: total reaction=4}}
+
{{#set: molecular weight=193.133    }}
−
{{#set: completion rate=50.0}}
+
{{#set: common name=aldehydo-D-glucuronic acid}}
 +
{{#set: reversible reaction associated=RXN-14693}}

Latest revision as of 20:25, 21 March 2018

Metabolite CPD-15530

  • smiles:
    • [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=IAJILQKETJEXLJ-QTBDOELSSA-M
  • common name:
    • aldehydo-D-glucuronate
  • molecular weight:
    • 193.133
  • Synonym(s):
    • aldehydo-D-glucuronic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-15530&oldid=26758"