Difference between revisions of "3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-09_000640 == * left end position: ** 827832 * transcription direction: ** NEGATIVE * right end position: ** 850282 * centisome position: ** 14.748...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN] == * smiles: ** CC(C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CC(C1(C(=CC(=CC=1O)O)O))=O)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VSDWHZGJGWMIRN-UHFFFAOYSA-N |
− | * | + | * common name: |
− | ** | + | ** phlorisovalerophenone |
− | * | + | * molecular weight: |
− | ** | + | ** 210.229 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one |
− | ** | + | ** PIVP |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7811]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441269 441269] | |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.390036.html 390036] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15951 15951] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C07350 C07350] | ||
+ | * HMDB : HMDB33798 | ||
+ | {{#set: smiles=CC(CC(C1(C(=CC(=CC=1O)O)O))=O)C}} | ||
+ | {{#set: inchi key=InChIKey=VSDWHZGJGWMIRN-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=phlorisovalerophenone}} | ||
+ | {{#set: molecular weight=210.229 }} | ||
+ | {{#set: common name=3-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one|PIVP}} | ||
+ | {{#set: consumed by=RXN-7811}} |
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN
- smiles:
- CC(CC(C1(C(=CC(=CC=1O)O)O))=O)C
- inchi key:
- InChIKey=VSDWHZGJGWMIRN-UHFFFAOYSA-N
- common name:
- phlorisovalerophenone
- molecular weight:
- 210.229
- Synonym(s):
- 3-methyl-1-(2,4,6-trihydroxyphenyl)butan-1-one
- PIVP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links