Difference between revisions of "PWY-6981"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O) * inchi ke...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6981 PWY-6981] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6447 TAX-64...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6981 PWY-6981] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6447 TAX-6447] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6231 TAX-6231] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6073 TAX-6073] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6040 TAX-6040] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5758 TAX-5758] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-6656 TAX-6656] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | ||
* common name: | * common name: | ||
| − | ** | + | ** chitin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''8''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[PGLUCISOM-RXN]] |
| − | * [ | + | ** 3 associated gene(s): |
| + | *** [[Ec-24_002470]] | ||
| + | *** [[Ec-13_003530]] | ||
| + | *** [[Ec-13_003810]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[PWY-5941]] | ||
| + | ** 0 associated gene: | ||
| + | * [[PWY0-1182]] | ||
| + | ** 0 associated gene: | ||
| + | * [[UDPNACETYLGALSYN-PWY]] | ||
| + | ** 0 associated gene: | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=CHITIN-SYNTHASE-RXN CHITIN-SYNTHASE-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-6447}} | |
| − | + | {{#set: taxonomic range=TAX-6231}} | |
| − | + | {{#set: taxonomic range=TAX-6073}} | |
| − | + | {{#set: taxonomic range=TAX-6040}} | |
| − | + | {{#set: taxonomic range=TAX-5758}} | |
| − | + | {{#set: taxonomic range=TAX-6656}} | |
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=chitin biosynthesis}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=8}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:25, 21 March 2018
Pathway PWY-6981
- taxonomic range:
- common name:
- chitin biosynthesis
- Synonym(s):
Reaction(s) found
4 reactions found over 8 reactions in the full pathway
- PGLUCISOM-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- PWY-5941
- 0 associated gene:
- PWY0-1182
- 0 associated gene:
- UDPNACETYLGALSYN-PWY
- 0 associated gene:
