Difference between revisions of "PWY-321"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-321 PWY-321] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-321 PWY-321] ==
* smiles:
+
* taxonomic range:
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** N-acetyl-serotonin sulfate
+
** cutin biosynthesis
* molecular weight:
+
** 297.305   
+
 
* Synonym(s):
 
* Synonym(s):
** N-acetyl-5-hydroxytryptamine sulfate
+
** cutin monomer biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''16''' reactions in the full pathway
* [[RXN-11059]]
+
* [[RXN-16389]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-12_008720]]
 +
*** [[Ec-01_001560]]
 +
*** [[Ec-02_006430]]
 +
*** [[Ec-03_003710]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PALMITOYL-COA-HYDROLASE-RXN PALMITOYL-COA-HYDROLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1062 RXN-1062]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1064 RXN-1064]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1065 RXN-1065]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16398 RXN-16398]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16400 RXN-16400]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16416 RXN-16416]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16417 RXN-16417]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9666 RXN-9666]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9802 RXN-9802]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9803 RXN-9803]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9804 RXN-9804]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9805 RXN-9805]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9806 RXN-9806]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9807 RXN-9807]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479248 45479248]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-321 PWY-321]
* HMDB : HMDB60834
+
{{#set: taxonomic range=TAX-33090}}
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
+
{{#set: common name=cutin biosynthesis}}
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
+
{{#set: common name=cutin monomer biosynthesis}}
{{#set: common name=N-acetyl-serotonin sulfate}}
+
{{#set: reaction found=1}}
{{#set: molecular weight=297.305    }}
+
{{#set: total reaction=16}}
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
+
{{#set: completion rate=6.0}}
{{#set: produced by=RXN-11059}}
+

Latest revision as of 20:25, 21 March 2018

Pathway PWY-321

  • taxonomic range:
  • common name:
    • cutin biosynthesis
  • Synonym(s):
    • cutin monomer biosynthesis

Reaction(s) found

1 reactions found over 16 reactions in the full pathway

Reaction(s) not found

External links