Difference between revisions of "Ec-00 003690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Ec-00_003690 == * left end position: ** 3944147 * transcription direction: ** POSITIVE * right end position: ** 3950674 * centisome position: ** 20.8...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] ==
+
== Gene Ec-00_003690 ==
−
* smiles:
+
* left end position:
−
** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
+
** 3944147
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** dehydroascorbate (bicyclic form)
+
** 3950674
−
* molecular weight:
+
* centisome position:
−
** 192.125    
+
** 20.81736    
 
* Synonym(s):
 
* Synonym(s):
−
** dehydroascorbate monohydrate
+
** Esi_0235_0029
 +
** Esi0235_0029
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12861]]
+
* Reaction: [[CARBOXYPEPTIDASE-A-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-12862]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3944147}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}}
+
{{#set: right end position=3950674}}
−
{{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}}
+
{{#set: centisome position=20.81736   }}
−
{{#set: common name=dehydroascorbate (bicyclic form)}}
+
{{#set: common name=Esi_0235_0029|Esi0235_0029}}
−
{{#set: molecular weight=192.125   }}
+
{{#set: reaction associated=CARBOXYPEPTIDASE-A-RXN}}
−
{{#set: common name=dehydroascorbate monohydrate}}
+
−
{{#set: consumed by=RXN-12861}}
+
−
{{#set: produced by=RXN-12862}}
+

Latest revision as of 19:25, 21 March 2018

Gene Ec-00_003690

  • left end position:
    • 3944147
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3950674
  • centisome position:
    • 20.81736
  • Synonym(s):
    • Esi_0235_0029
    • Esi0235_0029

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_003690&oldid=26815"