Difference between revisions of "PWY-702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * smiles: ** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702] ==
* smiles:
+
* taxonomic range:
** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
* inchi key:
+
** InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** octoketide
+
** L-methionine biosynthesis II
* molecular weight:
+
** 317.274   
+
 
* Synonym(s):
 
* Synonym(s):
** SEK4
+
** L-methionine biosynthesis via O-phospho-homoserine
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''6''' reactions found over '''6''' reactions in the full pathway
* [[RXN-10734]]
+
* [[CYSPH-RXN]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[HOMOCYSMET-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-06_000970]]
 +
*** [[Ec-28_003190]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-11_005000]]
 +
*** [[Ec-06_000980]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[HOMOSERKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_006270]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[MMUM-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-06_000980]]
 +
*** [[Ec-11_005000]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15131]]
 +
** 2 associated gene(s):
 +
*** [[Ec-00_002820]]
 +
*** [[Ec-05_006760]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237243 44237243]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-702 PWY-702]
{{#set: smiles=CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))}}
+
{{#set: taxonomic range=TAX-3193}}
{{#set: inchi key=InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M}}
+
{{#set: common name=L-methionine biosynthesis II}}
{{#set: common name=octoketide}}
+
{{#set: common name=L-methionine biosynthesis via O-phospho-homoserine}}
{{#set: molecular weight=317.274    }}
+
{{#set: reaction found=6}}
{{#set: common name=SEK4}}
+
{{#set: total reaction=6}}
{{#set: produced by=RXN-10734}}
+
{{#set: completion rate=100.0}}

Latest revision as of 19:25, 21 March 2018

Pathway PWY-702

  • taxonomic range:
  • common name:
    • L-methionine biosynthesis II
  • Synonym(s):
    • L-methionine biosynthesis via O-phospho-homoserine

Reaction(s) found

6 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links