Difference between revisions of "CPD-12017"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6520 PWY-6520] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6520 PWY-6520] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
 +
* inchi key:
 +
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
 
* common name:
 
* common name:
** nonaprenyl diphosphate biosynthesis II
+
** N-acetyl-serotonin sulfate
 +
* molecular weight:
 +
** 297.305   
 
* Synonym(s):
 
* Synonym(s):
** solanesyl diphosphate biosynthesis
+
** N-acetyl-5-hydroxytryptamine sulfate
** solanesyl pyrophosphate biosynthesis
+
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-11486]]
+
* [[RXN-11059]]
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Ec-17_003520]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* PUBCHEM:
{{#set: common name=nonaprenyl diphosphate biosynthesis II}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479248 45479248]
{{#set: common name=solanesyl diphosphate biosynthesis|solanesyl pyrophosphate biosynthesis}}
+
* HMDB : HMDB60834
{{#set: reaction found=1}}
+
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
{{#set: total reaction=1}}
+
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
{{#set: completion rate=100.0}}
+
{{#set: common name=N-acetyl-serotonin sulfate}}
 +
{{#set: molecular weight=297.305    }}
 +
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
 +
{{#set: produced by=RXN-11059}}

Latest revision as of 19:25, 21 March 2018

Metabolite CPD-12017

  • smiles:
    • CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
  • inchi key:
    • InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
  • common name:
    • N-acetyl-serotonin sulfate
  • molecular weight:
    • 297.305
  • Synonym(s):
    • N-acetyl-5-hydroxytryptamine sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))" cannot be used as a page name in this wiki.