Difference between revisions of "PWY-6520"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] == * smiles: ** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6520 PWY-6520] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHACRYLYL-COA METHACRYLYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6520 PWY-6520] ==
* smiles:
+
* taxonomic range:
** C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J
+
 
* common name:
 
* common name:
** methylacrylyl-CoA
+
** nonaprenyl diphosphate biosynthesis II
* molecular weight:
+
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
** methacrylyl-CoA
+
** solanesyl diphosphate biosynthesis
** 2-methylprop-2-enoyl-CoA
+
** solanesyl pyrophosphate biosynthesis
** methacrylyl-coenzyme A
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''1''' reactions in the full pathway
* [[MEPROPCOA-FAD-RXN]]
+
* [[RXN-11486]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
*** [[Ec-17_003520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 6008-91-9
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=nonaprenyl diphosphate biosynthesis II}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262325 53262325]
+
{{#set: common name=solanesyl diphosphate biosynthesis|solanesyl pyrophosphate biosynthesis}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62500 62500]
+
{{#set: total reaction=1}}
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C03460 C03460]
+
* HMDB : HMDB01011
+
{{#set: smiles=C=C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
{{#set: inchi key=InChIKey=NPALUEYCDZWBOV-NDZSKPAWSA-J}}
+
{{#set: common name=methylacrylyl-CoA}}
+
{{#set: molecular weight=831.577    }}
+
{{#set: common name=methacrylyl-CoA|2-methylprop-2-enoyl-CoA|methacrylyl-coenzyme A}}
+
{{#set: produced by=MEPROPCOA-FAD-RXN}}
+
{{#set: consumed or produced by=METHYLACYLYLCOA-HYDROXY-RXN}}
+

Latest revision as of 19:25, 21 March 2018

Pathway PWY-6520

  • taxonomic range:
  • common name:
    • nonaprenyl diphosphate biosynthesis II
  • Synonym(s):
    • solanesyl diphosphate biosynthesis
    • solanesyl pyrophosphate biosynthesis

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links