Difference between revisions of "CPD-13907"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12503 RXN-12503] == * direction: ** REVERSIBLE * common name: ** tRNAHis guanylyltransferase Th...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] == * smiles: ** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2)) * inchi key: ** InCh...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12503 RXN-12503] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13907 CPD-13907] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
 +
* inchi key:
 +
** InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
 
* common name:
 
* common name:
** tRNAHis guanylyltransferase Thg1
+
** dehydroascorbate (bicyclic form)
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.7.7.79 EC-2.7.7.79]
+
** 192.125   
 
* Synonym(s):
 
* Synonym(s):
 +
** dehydroascorbate monohydrate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-12861]]
** 1 [[ATP]][c] '''+''' 1 [[p-his-tRNAS]][c] '''<=>''' 1 [[App-his-tRNAs]][c] '''+''' 1 [[PPI]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-12862]]
** 1 ATP[c] '''+''' 1 p-tRNAHis[c] '''<=>''' 1 App-tRNAHis[c] '''+''' 1 diphosphate[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-26_001350]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: AUTOMATED-NAME-MATCH
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
{{#set: common name=tRNAHis guanylyltransferase Thg1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659000 90659000]
{{#set: ec number=EC-2.7.7.79}}
+
{{#set: smiles=C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))}}
{{#set: gene associated=Ec-26_001350}}
+
{{#set: inchi key=InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N}}
{{#set: in pathway=}}
+
{{#set: common name=dehydroascorbate (bicyclic form)}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=192.125    }}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=dehydroascorbate monohydrate}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-12861}}
 +
{{#set: produced by=RXN-12862}}

Latest revision as of 20:26, 21 March 2018

Metabolite CPD-13907

  • smiles:
    • C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))
  • inchi key:
    • InChIKey=QPPOKIPSRPKDEM-VPGXFDHMSA-N
  • common name:
    • dehydroascorbate (bicyclic form)
  • molecular weight:
    • 192.125
  • Synonym(s):
    • dehydroascorbate monohydrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=O)(O[CH]1(C(O)(OCC(O)1)C(O)(O)2))" cannot be used as a page name in this wiki.