Difference between revisions of "Ec-16 000550"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8652 CPD-8652] == * smiles: ** C([O-])(=O)C1(NC2(=C(C1)C=C(O)C(O)=C2)) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-16_000550 == * Synonym(s): ** Esi_0400_0012 ** Esi0400_0012 == Reactions associated == * Reaction: RXN-14177 ** Source: orthology-aragem...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-16_000550 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0400_0012 |
− | ** | + | ** Esi0400_0012 |
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-14177]] |
− | + | ** Source: [[orthology-aragem]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0400_0012|Esi0400_0012}} | |
− | + | {{#set: reaction associated=RXN-14177}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:26, 21 March 2018
Gene Ec-16_000550
- Synonym(s):
- Esi_0400_0012
- Esi0400_0012
Reactions associated
- Reaction: RXN-14177
- Source: orthology-aragem