Difference between revisions of "CPD-14928"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9463 RXN-9463] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-1,2-fucosyltransferase,...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
| + | * inchi key: | ||
| + | ** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** phytenoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1056.006 |
* Synonym(s): | * Synonym(s): | ||
| + | ** E-phytenoyl-CoA | ||
| + | ** trans-phytenoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN66-482]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-480]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969] |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}} |
| − | {{#set: | + | {{#set: common name=phytenoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=1056.006 }} |
| − | {{#set: | + | {{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN66-482}} |
| + | {{#set: produced by=RXN66-480}} | ||
Latest revision as of 20:26, 21 March 2018
Contents
Metabolite CPD-14928
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
- common name:
- phytenoyl-CoA
- molecular weight:
- 1056.006
- Synonym(s):
- E-phytenoyl-CoA
- trans-phytenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
