Difference between revisions of "DUTP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_NITRATE TransportSeed_NITRATE] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Rea...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)N...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) |
| + | * inchi key: | ||
| + | ** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J | ||
| + | * common name: | ||
| + | ** dUTP | ||
| + | * molecular weight: | ||
| + | ** 464.112 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** deoxy-UTP | ||
| + | ** 2'-deoxyuridine-5'-triphosphate | ||
| + | ** deoxyuridine-triphosphate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[DUTP-PYROP-RXN]] |
| − | + | * [[RXN-14199]] | |
| − | * | + | * [[RXN-14219]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[DUDPKIN-RXN]] | |
| − | == | + | * [[RXN0-724]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 1173-82-6 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408] |
| − | {{#set: | + | * HMDB : HMDB01191 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555] | ||
| + | * BIGG : 35037 | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}} | ||
| + | {{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}} | ||
| + | {{#set: common name=dUTP}} | ||
| + | {{#set: molecular weight=464.112 }} | ||
| + | {{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}} | ||
| + | {{#set: consumed by=DUTP-PYROP-RXN|RXN-14199|RXN-14219}} | ||
| + | {{#set: produced by=DUDPKIN-RXN|RXN0-724}} | ||
Latest revision as of 20:26, 21 March 2018
Contents
Metabolite DUTP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
- inchi key:
- InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
- common name:
- dUTP
- molecular weight:
- 464.112
- Synonym(s):
- deoxy-UTP
- 2'-deoxyuridine-5'-triphosphate
- deoxyuridine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.
