Difference between revisions of "Ec-03 005360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)N...")
 
(Created page with "Category:Gene == Gene Ec-03_005360 == * Synonym(s): ** Esi_0160_0023 ** Esi0160_0023 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] ==
+
== Gene Ec-03_005360 ==
−
* smiles:
+
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
+
−
* inchi key:
+
−
** InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J
+
−
* common name:
+
−
** dUTP
+
−
* molecular weight:
+
−
** 464.112   
+
 
* Synonym(s):
 
* Synonym(s):
−
** deoxy-UTP
+
** Esi_0160_0023
−
** 2'-deoxyuridine-5'-triphosphate
+
** Esi0160_0023
−
** deoxyuridine-triphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[DUTP-PYROP-RXN]]
+
* Reaction: [[RXN-8443]]
−
* [[RXN-14199]]
+
** Source: [[orthology-aragem]]
−
* [[RXN-14219]]
+
== Pathways associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PWY-5381]]
−
* [[DUDPKIN-RXN]]
+
−
* [[RXN0-724]]
+
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* CAS : 1173-82-6
+
{{#set: common name=Esi_0160_0023|Esi0160_0023}}
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-8443}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244408 25244408]
+
{{#set: pathway associated=PWY-5381}}
−
* HMDB : HMDB01191
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00460 C00460]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61555 61555]
+
−
* BIGG : 35037
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=AHCYMLUZIRLXAA-SHYZEUOFSA-J}}
+
−
{{#set: common name=dUTP}}
+
−
{{#set: molecular weight=464.112    }}
+
−
{{#set: common name=deoxy-UTP|2'-deoxyuridine-5'-triphosphate|deoxyuridine-triphosphate}}
+
−
{{#set: consumed by=DUTP-PYROP-RXN|RXN-14199|RXN-14219}}
+
−
{{#set: produced by=DUDPKIN-RXN|RXN0-724}}
+

Latest revision as of 19:26, 21 March 2018

Gene Ec-03_005360

  • Synonym(s):
    • Esi_0160_0023
    • Esi0160_0023

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_005360&oldid=26876"