Difference between revisions of "CPD-13559"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(O)C1(C(O)C(O)C(O)C(O)O1)
 +
* inchi key:
 +
** InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N
 
* common name:
 
* common name:
** L-ascorbate biosynthesis I (L-galactose pathway)
+
** α-D-mannopyranose
 +
* molecular weight:
 +
** 180.157   
 
* Synonym(s):
 
* Synonym(s):
** vitamin C biosynthesis
 
** ascorbic acid biosynthesis
 
** L-ascorbic acid biosynthesis I
 
** Smirnoff-Wheeler pathway
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''7''' reactions found over '''8''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[2.7.7.13-RXN]]
+
* [[3.2.1.114-RXN]]
** 0 associated gene:
+
* [[3.2.1.24-RXN]]
** 1 reconstruction source(s) associated:
+
== Reaction(s) of unknown directionality ==
*** [[annotation-esiliculosus_genome]]
+
* [[MANNPISOM-RXN]]
+
** 4 associated gene(s):
+
*** [[Ec-20_000830]]
+
*** [[Ec-27_005440]]
+
*** [[Ec-28_000050]]
+
*** [[Ec-28_000080]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[PHOSMANMUT-RXN]]
+
** 2 associated gene(s):
+
*** [[Ec-08_004630]]
+
*** [[Ec-17_001480]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[RXN-1882]]
+
** 1 associated gene(s):
+
*** [[Ec-06_004510]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[RXN-1884]]
+
** 5 associated gene(s):
+
*** [[Ec-27_000770]]
+
*** [[Ec-14_001520]]
+
*** [[Ec-12_007760]]
+
*** [[Ec-27_006410]]
+
*** [[Ec-27_001700]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-aragem]]
+
* [[RXNQT-4141]]
+
** 1 associated gene(s):
+
*** [[Ec-15_001960]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[RXNQT-4142]]
+
** 1 associated gene(s):
+
*** [[Ec-21_004120]]
+
** 1 reconstruction source(s) associated:
+
*** [[orthology-aragem]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=GALACTONOLACTONE-DEHYDROGENASE-RXN GALACTONOLACTONE-DEHYDROGENASE-RXN]
+
 
== External links  ==
 
== External links  ==
* ARACYC:
+
* PUBCHEM:
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-882 PWY-882]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=185698 185698]
{{#set: taxonomic range=TAX-33090}}
+
* CHEBI:
{{#set: common name=L-ascorbate biosynthesis I (L-galactose pathway)}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28729 28729]
{{#set: common name=vitamin C biosynthesis|ascorbic acid biosynthesis|L-ascorbic acid biosynthesis I|Smirnoff-Wheeler pathway}}
+
* METABOLIGHTS : MTBLC28729
{{#set: reaction found=7}}
+
* LIGAND-CPD:
{{#set: total reaction=8}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00936 C00936]
{{#set: completion rate=88.0}}
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O)O1)}}
 +
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N}}
 +
{{#set: common name=α-D-mannopyranose}}
 +
{{#set: molecular weight=180.157    }}
 +
{{#set: produced by=3.2.1.114-RXN|3.2.1.24-RXN}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPD-13559

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O)O1)
  • inchi key:
    • InChIKey=WQZGKKKJIJFFOK-PQMKYFCFSA-N
  • common name:
    • α-D-mannopyranose
  • molecular weight:
    • 180.157
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links