Difference between revisions of "CPD-8890"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12869 RXN-12869] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8890 CPD-8890] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3) |
| + | * inchi key: | ||
| + | ** InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L | ||
| + | * common name: | ||
| + | ** betanidin quinone | ||
| + | * molecular weight: | ||
| + | ** 384.301 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8635]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246300 25246300] |
| − | {{#set: | + | {{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L}} |
| − | {{#set: | + | {{#set: common name=betanidin quinone}} |
| + | {{#set: molecular weight=384.301 }} | ||
| + | {{#set: produced by=RXN-8635}} | ||
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-8890
- smiles:
- C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
- inchi key:
- InChIKey=MCTHLMSFLMEBEK-AAEUAGOBSA-L
- common name:
- betanidin quinone
- molecular weight:
- 384.301
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=[N+]1(C(C([O-])=O)CC2(C1=CC(=O)C(=O)C=2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)" cannot be used as a page name in this wiki.
