Difference between revisions of "BTUR2-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * smiles: ** C(C(C1(C=CC(=CC=1)O))OC2(OC(C(C(C2O)O)O)CO))#N * inchi key:...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BTUR2-RXN BTUR2-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** cob(I)yrinic acid a,c-diami...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BTUR2-RXN BTUR2-RXN] ==
−
* smiles:
+
* direction:
−
** C(C(C1(C=CC(=CC=1)O))OC2(OC(C(C(C2O)O)O)CO))#N
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N
+
 
* common name:
 
* common name:
−
** taxiphyllin
+
** cob(I)yrinic acid a,c-diamide adenosyltransferase
−
* molecular weight:
+
* ec number:
−
** 311.291   
+
** [http://enzyme.expasy.org/EC/2.5.1.17 EC-2.5.1.17]
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-4-hydroxymandelonitrile β-D-glucoside
 
−
** (2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile
 
−
** (R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13600]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[COBINAMIDE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADENOSYLCOBINAMIDE]][c] '''+''' 1 [[P3I]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 cobinamide[c] '''+''' 1 ATP[c] '''=>''' 1 adenosylcobinamide[c] '''+''' 1 PPPi[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_010830]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[COBALSYN-PWY]], adenosylcobalamin salvage from cobinamide I: [http://metacyc.org/META/NEW-IMAGE?object=COBALSYN-PWY COBALSYN-PWY]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-6269]], adenosylcobalamin salvage from cobinamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6269 PWY-6269]
 +
** '''1''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 21401-21-8
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14725 14725]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107721 107721]
+
* LIGAND-RXN:
−
* HMDB : HMDB30704
+
** [http://www.genome.jp/dbget-bin/www_bget?R07268 R07268]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01855 C01855]
+
{{#set: common name=cob(I)yrinic acid a,c-diamide adenosyltransferase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-2.5.1.17}}
−
** [http://www.chemspider.com/Chemical-Structure.96890.html 96890]
+
{{#set: gene associated=Ec-06_010830}}
−
* CHEBI:
+
{{#set: in pathway=COBALSYN-PWY|PWY-6269}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16267 16267]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C(C(C1(C=CC(=CC=1)O))OC2(OC(C(C(C2O)O)O)CO))#N}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=NVLTYOJHPBMILU-GMDXDWKASA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=taxiphyllin}}
+
−
{{#set: molecular weight=311.291    }}
+
−
{{#set: common name=(R)-4-hydroxymandelonitrile β-D-glucoside|(2R)-(β-D-glucopyranosyloxy)(4-hydroxyphenyl)acetonitrile|(R)-alpha-(β-D-glucopyranosyloxy)-4-hydroxybenzeneacetonitrile}}
+
−
{{#set: consumed by=RXN-13600}}
+

Latest revision as of 19:26, 21 March 2018

Reaction BTUR2-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cob(I)yrinic acid a,c-diamide adenosyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 cobinamide[c] + 1 ATP[c] => 1 adenosylcobinamide[c] + 1 PPPi[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • COBALSYN-PWY, adenosylcobalamin salvage from cobinamide I: COBALSYN-PWY
    • 1 reactions found over 6 reactions in the full pathway
  • PWY-6269, adenosylcobalamin salvage from cobinamide II: PWY-6269
    • 1 reactions found over 7 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=BTUR2-RXN&oldid=26893"