Difference between revisions of "PWY-882"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] ==
* smiles:
+
* taxonomic range:
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** N-acetyl-serotonin sulfate
+
** L-ascorbate biosynthesis I (L-galactose pathway)
* molecular weight:
+
** 297.305   
+
 
* Synonym(s):
 
* Synonym(s):
** N-acetyl-5-hydroxytryptamine sulfate
+
** vitamin C biosynthesis
 +
** ascorbic acid biosynthesis
 +
** L-ascorbic acid biosynthesis I
 +
** Smirnoff-Wheeler pathway
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''7''' reactions found over '''8''' reactions in the full pathway
* [[RXN-11059]]
+
* [[2.7.7.13-RXN]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[MANNPISOM-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-20_000830]]
 +
*** [[Ec-28_000080]]
 +
*** [[Ec-28_000050]]
 +
*** [[Ec-27_005440]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PHOSMANMUT-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-17_001480]]
 +
*** [[Ec-08_004630]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-1882]]
 +
** 1 associated gene(s):
 +
*** [[Ec-06_004510]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-1884]]
 +
** 5 associated gene(s):
 +
*** [[Ec-27_006410]]
 +
*** [[Ec-14_001520]]
 +
*** [[Ec-12_007760]]
 +
*** [[Ec-27_000770]]
 +
*** [[Ec-27_001700]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXNQT-4141]]
 +
** 1 associated gene(s):
 +
*** [[Ec-15_001960]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXNQT-4142]]
 +
** 1 associated gene(s):
 +
*** [[Ec-21_004120]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GALACTONOLACTONE-DEHYDROGENASE-RXN GALACTONOLACTONE-DEHYDROGENASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479248 45479248]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-882 PWY-882]
* HMDB : HMDB60834
+
{{#set: taxonomic range=TAX-33090}}
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
+
{{#set: common name=L-ascorbate biosynthesis I (L-galactose pathway)}}
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
+
{{#set: common name=vitamin C biosynthesis|ascorbic acid biosynthesis|L-ascorbic acid biosynthesis I|Smirnoff-Wheeler pathway}}
{{#set: common name=N-acetyl-serotonin sulfate}}
+
{{#set: reaction found=7}}
{{#set: molecular weight=297.305    }}
+
{{#set: total reaction=8}}
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
+
{{#set: completion rate=88.0}}
{{#set: produced by=RXN-11059}}
+

Latest revision as of 20:26, 21 March 2018

Pathway PWY-882

  • taxonomic range:
  • common name:
    • L-ascorbate biosynthesis I (L-galactose pathway)
  • Synonym(s):
    • vitamin C biosynthesis
    • ascorbic acid biosynthesis
    • L-ascorbic acid biosynthesis I
    • Smirnoff-Wheeler pathway

Reaction(s) found

7 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links