Difference between revisions of "Ec-21 003740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...")
 
(Created page with "Category:Gene == Gene Ec-21_003740 == * left end position: ** 4732928 * transcription direction: ** POSITIVE * right end position: ** 4743041 * centisome position: ** 64.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] ==
+
== Gene Ec-21_003740 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C
+
** 4732928
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YYGNTYWPHWGJRM-AAJYLUCBSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** squalene
+
** 4743041
−
* molecular weight:
+
* centisome position:
−
** 410.725    
+
** 64.13078    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0072_0110
 +
** Esi0072_0110
 +
** NFS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[SQUALENE-MONOOXYGENASE-RXN]]
+
* Reaction: [[RXN-12587]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-13724]]
+
*** Assignment: ec-number
−
* [[RXN66-281]]
+
* Reaction: [[RXN-12588]]
−
* [[RXN-13162]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-14382]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14384]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14385]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14386]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15881]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9787]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-308]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1021]]
 +
* [[PWY-6823]]
 +
* [[PWY-7250]]
 +
* [[PWY-6892]]
 +
* [[PWY-6891]]
 
== External links  ==
 
== External links  ==
−
* CAS : 111-02-4
+
{{#set: left end position=4732928}}
−
* LIPID_MAPS : LMPR0106010002
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: right end position=4743041}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=638072 638072]
+
{{#set: centisome position=64.13078    }}
−
* HMDB : HMDB00256
+
{{#set: common name=Esi_0072_0110|Esi0072_0110|NFS}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-12587|RXN-12588|RXN-14382|RXN-14384|RXN-14385|RXN-14386|RXN-15881|RXN-9787|RXN0-308}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00751 C00751]
+
{{#set: pathway associated=PWY0-1021|PWY-6823|PWY-7250|PWY-6892|PWY-6891}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15440 15440]
+
−
* METABOLIGHTS : MTBLC15440
+
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C}}
+
−
{{#set: inchi key=InChIKey=YYGNTYWPHWGJRM-AAJYLUCBSA-N}}
+
−
{{#set: common name=squalene}}
+
−
{{#set: molecular weight=410.725    }}
+
−
{{#set: consumed by=SQUALENE-MONOOXYGENASE-RXN}}
+
−
{{#set: produced by=RXN-13724|RXN66-281|RXN-13162}}
+

Latest revision as of 19:26, 21 March 2018

Gene Ec-21_003740

  • left end position:
    • 4732928
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4743041
  • centisome position:
    • 64.13078
  • Synonym(s):
    • Esi_0072_0110
    • Esi0072_0110
    • NFS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_003740&oldid=26920"