Difference between revisions of "CDP-ETHANOLAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * smiles: ** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] == * smiles: ** C(COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)([O-])=O)[N+] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=WVIMUEUQJFPNDK-PEBGCTIMSA-M |
* common name: | * common name: | ||
| − | ** | + | ** CDP-ethanolamine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 445.239 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cytidine diphosphate ethanolamine |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.7.14-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 3036-18-8 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202847 25202847] |
| − | {{#set: smiles= | + | * HMDB : HMDB01564 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00570 C00570] |
| − | {{#set: molecular weight= | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57876 57876] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC57876 |
| + | {{#set: smiles=C(COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)([O-])=O)[N+]}} | ||
| + | {{#set: inchi key=InChIKey=WVIMUEUQJFPNDK-PEBGCTIMSA-M}} | ||
| + | {{#set: common name=CDP-ethanolamine}} | ||
| + | {{#set: molecular weight=445.239 }} | ||
| + | {{#set: common name=cytidine diphosphate ethanolamine}} | ||
| + | {{#set: consumed by=ETHANOLAMINEPHOSPHOTRANSFERASE-RXN}} | ||
| + | {{#set: produced by=2.7.7.14-RXN}} | ||
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CDP-ETHANOLAMINE
- smiles:
- C(COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)([O-])=O)[N+]
- inchi key:
- InChIKey=WVIMUEUQJFPNDK-PEBGCTIMSA-M
- common name:
- CDP-ethanolamine
- molecular weight:
- 445.239
- Synonym(s):
- cytidine diphosphate ethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 3036-18-8
- PUBCHEM:
- HMDB : HMDB01564
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57876
"C(COP(OP(OCC2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))([O-])=O)([O-])=O)[N+" cannot be used as a page name in this wiki.
