Difference between revisions of "MALONYL-ACP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] == * smiles: ** CC(CC([N+])C([O-])=O)C * inchi key: ** InChIKey=ROHFNLRQFUQHCH-YFKPBYR...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACP MALONYL-ACP] == * common name: ** a malonyl-[acp] * Synonym(s): ** malonyl-[acyl-ca...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU LEU] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACP MALONYL-ACP] ==
* smiles:
+
** CC(CC([N+])C([O-])=O)C
+
* inchi key:
+
** InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N
+
 
* common name:
 
* common name:
** L-leucine
+
** a malonyl-[acp]
* molecular weight:
+
** 131.174   
+
 
* Synonym(s):
 
* Synonym(s):
** (2S)-α-2-amino-4-methylvaleric acid
+
** malonyl-[acyl-carrier protein]
** L
+
** malonyl-S-ACP
** leu
+
** malonyl-acyl-carrier-protein
** leucine
+
** 2-amino-4-methylvaleric acid
+
** (2S)-α-leucine
+
** L-leu
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[LEUCINE--TRNA-LIGASE-RXN]]
+
* [[RXN-16629]]
* [[biomass_rxn]]
+
* [[RXN-11474]]
 +
* [[RXN-9535]]
 +
* [[RXN-14972]]
 +
* [[3-OXOACYL-ACP-SYNTH-RXN]]
 +
* [[RXN-16621]]
 +
* [[RXN-16625]]
 +
* [[RXN-11479]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[RXN-9527]]
 +
* [[RXN0-2141]]
 +
* [[2.3.1.179-RXN]]
 +
* [[RXN-9523]]
 +
* [[RXN3O-1803]]
 +
* [[RXN-10654]]
 +
* [[RXN-9539]]
 +
* [[RXN-10658]]
 +
* [[RXN-9531]]
 +
* [[RXN-9516]]
 +
* [[RXN-16615]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
+
* [[2.3.1.41-RXN]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN1G-460]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 
== External links  ==
 
== External links  ==
* NCI:
+
{{#set: common name=a malonyl-[acp]}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=46709 46709]
+
{{#set: common name=malonyl-[acyl-carrier protein]|malonyl-S-ACP|malonyl-acyl-carrier-protein}}
* CAS : 61-90-5
+
{{#set: consumed by=RXN-16629|RXN-11474|RXN-9535|RXN-14972|3-OXOACYL-ACP-SYNTH-RXN|RXN-16621|RXN-16625|RXN-11479|3-OXOACYL-ACP-SYNTH-BASE-RXN|RXN-9527|RXN0-2141|2.3.1.179-RXN|RXN-9523|RXN3O-1803|RXN-10654|RXN-9539|RXN-10658|RXN-9531|RXN-9516|RXN-16615}}
* BIGG : 33942
+
{{#set: reversible reaction associated=2.3.1.41-RXN|RXN-8349_PLANTCYC|RXN1G-460|MALONYL-COA-ACP-TRANSACYL-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7045798 7045798]
+
* HMDB : HMDB00687
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00123 C00123]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57427 57427]
+
* METABOLIGHTS : MTBLC57427
+
{{#set: smiles=CC(CC([N+])C([O-])=O)C}}
+
{{#set: inchi key=InChIKey=ROHFNLRQFUQHCH-YFKPBYRVSA-N}}
+
{{#set: common name=L-leucine}}
+
{{#set: molecular weight=131.174    }}
+
{{#set: common name=(2S)-α-2-amino-4-methylvaleric acid|L|leu|leucine|2-amino-4-methylvaleric acid|(2S)-α-leucine|L-leu}}
+
{{#set: consumed by=LEUCINE--TRNA-LIGASE-RXN|biomass_rxn}}
+
{{#set: consumed or produced by=BRANCHED-CHAINAMINOTRANSFERLEU-RXN}}
+

Latest revision as of 19:26, 21 March 2018

Metabolite MALONYL-ACP

  • common name:
    • a malonyl-[acp]
  • Synonym(s):
    • malonyl-[acyl-carrier protein]
    • malonyl-S-ACP
    • malonyl-acyl-carrier-protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a malonyl-[acp" cannot be used as a page name in this wiki.
"malonyl-[acyl-carrier protein" cannot be used as a page name in this wiki.