Difference between revisions of "RXN-4144"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4144 RXN-4144] == * direction: ** LEFT-TO-RIGHT * common name: ** 4α-methyl-5α-ergo...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4144 RXN-4144] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** β- | + | ** 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol Δ14 reductase |
− | * | + | ** Delta14-sterol reductase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.3.1.70 EC-1.3.1.70] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ALPHA-METHYL-5-ALPHA-ERGOSTA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-4081]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 4α-methyl-5α-ergosta-8,24-dien-3β-ol[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-10_001280]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541] | ||
+ | ** '''10''' reactions found over '''36''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07483 R07483] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol Δ14 reductase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=Delta14-sterol reductase}} |
− | + | {{#set: ec number=EC-1.3.1.70}} | |
− | + | {{#set: gene associated=Ec-10_001280}} | |
− | + | {{#set: in pathway=PWY-2541}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:26, 21 March 2018
Contents
Reaction RXN-4144
- direction:
- LEFT-TO-RIGHT
- common name:
- 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol Δ14 reductase
- Delta14-sterol reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ALPHA-METHYL-5-ALPHA-ERGOSTA[c] + 1 PROTON[c] + 1 NADPH[c] => 1 NADP[c] + 1 CPD-4081[c]
- With common name(s):
- 1 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol[c] + 1 H+[c] + 1 NADPH[c] => 1 NADP+[c] + 1 4α-methyl-5α-ergosta-8,24-dien-3β-ol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-10_001280
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY-2541, plant sterol biosynthesis: PWY-2541
- 10 reactions found over 36 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- LIGAND-RXN: