Difference between revisions of "RXN-4144"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * inchi key: ** InChIKey=WQZGKK...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4144 RXN-4144] == * direction: ** LEFT-TO-RIGHT * common name: ** 4α-methyl-5α-ergo...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4144 RXN-4144] ==
−
* smiles:
+
* direction:
−
** C(O)C1(C(O)C(O)C(O)C(O)O1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WQZGKKKJIJFFOK-RWOPYEJCSA-N
+
 
* common name:
 
* common name:
−
** β-D-mannopyranose
+
** 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol Δ14 reductase
−
* molecular weight:
+
** Delta14-sterol reductase
−
** 180.157   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.70 EC-1.3.1.70]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14501]]
+
** 1 [[ALPHA-METHYL-5-ALPHA-ERGOSTA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-4081]][c]
−
* [[3.2.1.25-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 4α-methyl-5α-ergosta-8,24-dien-3β-ol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_001280]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541]
 +
** '''10''' reactions found over '''36''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB02687
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07483 R07483]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439680 439680]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol Δ14 reductase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02209 C02209]
+
{{#set: common name=Delta14-sterol reductase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.1.70}}
−
** [http://www.chemspider.com/Chemical-Structure.388747.html 388747]
+
{{#set: gene associated=Ec-10_001280}}
−
* CHEBI:
+
{{#set: in pathway=PWY-2541}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28563 28563]
+
{{#set: reconstruction category=orthology|annotation}}
−
* METABOLIGHTS : MTBLC28563
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O)O1)}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: inchi key=InChIKey=WQZGKKKJIJFFOK-RWOPYEJCSA-N}}
+
−
{{#set: common name=β-D-mannopyranose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: produced by=RXN-14501|3.2.1.25-RXN}}
+

Latest revision as of 19:26, 21 March 2018

Reaction RXN-4144

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol Δ14 reductase
    • Delta14-sterol reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4α-methyl-5α-ergosta-8,14,24(28)-trien-3β-ol[c] + 1 H+[c] + 1 NADPH[c] => 1 NADP+[c] + 1 4α-methyl-5α-ergosta-8,24-dien-3β-ol[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2541, plant sterol biosynthesis: PWY-2541
    • 10 reactions found over 36 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-4144&oldid=26955"