|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLURS-RXN GLURS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| + | * inchi key: |
| + | ** InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N |
| * common name: | | * common name: |
− | ** glutamate-tRNA ligase | + | ** ergosta-5,7-dienol |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/6.1.1.17 EC-6.1.1.17] | + | ** 398.671 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[ATP]][c] '''+''' 1 [[GLT-tRNAs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[GLT]][c] '''=>''' 1 [[Charged-GLT-tRNAs]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c]
| + | * [[RXN-13883]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 ATP[c] '''+''' 1 a tRNAglu[c] '''+''' 1 H+[c] '''+''' 1 L-glutamate[c] '''=>''' 1 an L-glutamyl-[tRNAGlu][c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Ec-06_008480]] | + | |
− | ** ESILICULOSUS_GENOME
| + | |
− | ***GO-TERM
| + | |
− | == Pathways == | + | |
− | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY]
| + | |
− | ** '''21''' reactions found over '''21''' reactions in the full pathway
| + | |
− | * [[PWY-5188]], tetrapyrrole biosynthesis I (from glutamate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5188 PWY-5188]
| + | |
− | ** '''6''' reactions found over '''6''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-esiliculosus_genome]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23540 23540] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659257 90659257] |
− | * LIGAND-RXN:
| + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R05578 R05578]
| + | {{#set: inchi key=InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N}} |
− | * UNIPROT:
| + | {{#set: common name=ergosta-5,7-dienol}} |
− | ** [http://www.uniprot.org/uniprot/P47700 P47700]
| + | {{#set: molecular weight=398.671 }} |
− | ** [http://www.uniprot.org/uniprot/O52914 O52914]
| + | {{#set: produced by=RXN-13883}} |
− | ** [http://www.uniprot.org/uniprot/P43818 P43818]
| + | |
− | ** [http://www.uniprot.org/uniprot/O26157 O26157]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZLJ1 Q9ZLJ1]
| + | |
− | ** [http://www.uniprot.org/uniprot/O25360 O25360]
| + | |
− | ** [http://www.uniprot.org/uniprot/O51345 O51345]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z7Z3 Q9Z7Z3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P96551 P96551]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67271 O67271]
| + | |
− | ** [http://www.uniprot.org/uniprot/O83679 O83679]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZLZ7 Q9ZLZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PP78 Q9PP78]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CDZ7 Q9CDZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84451 O84451]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X2I8 Q9X2I8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JWT4 Q9JWT4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZDK3 Q9ZDK3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X172 Q9X172]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58772 Q58772]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZCT8 Q9ZCT8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P59690 P59690]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43768 Q43768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43794 Q43794]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46655 P46655]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48525 P48525]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75114 P75114]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49061 Q49061]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22249 P22249]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22250 P22250]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04805 P04805]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07814 P07814]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15189 P15189]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65253 O65253]
| + | |
− | ** [http://www.uniprot.org/uniprot/O68055 O68055]
| + | |
− | ** [http://www.uniprot.org/uniprot/O68142 O68142]
| + | |
− | ** [http://www.uniprot.org/uniprot/O86528 O86528]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13775 O13775]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZFA3 Q9ZFA3]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82462 O82462]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=glutamate-tRNA ligase}}
| + | |
− | {{#set: ec number=EC-6.1.1.17}}
| + | |
− | {{#set: gene associated=Ec-06_008480}} | + | |
− | {{#set: in pathway=TRNA-CHARGING-PWY|PWY-5188}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction source=annotation-esiliculosus_genome}} | + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |