Difference between revisions of "CPD-14894"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_010740 == * left end position: ** 9055504 * transcription direction: ** POSITIVE * right end position: ** 9061356 * centisome position: ** 87.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N |
| − | * | + | * common name: |
| − | ** | + | ** ergosta-5,7-dienol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 398.671 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-13883]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659257 90659257] |
| − | {{#set: | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N}} |
| − | {{#set: | + | {{#set: common name=ergosta-5,7-dienol}} |
| − | {{#set: | + | {{#set: molecular weight=398.671 }} |
| + | {{#set: produced by=RXN-13883}} | ||
Latest revision as of 20:26, 21 March 2018
Contents
Metabolite CPD-14894
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N
- common name:
- ergosta-5,7-dienol
- molecular weight:
- 398.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
