Difference between revisions of "CPD-14894"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6109 PWY-6109] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40029 TAX-4...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6109 PWY-6109] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14894 CPD-14894] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40029 TAX-40029]
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N
 
* common name:
 
* common name:
** mangrove triterpenoid biosynthesis
+
** ergosta-5,7-dienol
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
** taraxerol biosynthesis
 
** germanicol biosynthesis
 
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[CYCLOARTENOL-SYNTHASE-RXN]]
+
* [[RXN-13883]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* '''5''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8434 RXN-8434]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9915 RXN-9915]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-9916 RXN-9916]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-111 RXN-111]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7570 RXN-7570]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-40029}}
+
* PUBCHEM:
{{#set: common name=mangrove triterpenoid biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659257 90659257]
{{#set: common name=taraxerol biosynthesis|germanicol biosynthesis}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
{{#set: reaction found=1}}
+
{{#set: inchi key=InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N}}
{{#set: reaction not found=5}}
+
{{#set: common name=ergosta-5,7-dienol}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: produced by=RXN-13883}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPD-14894

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ZKQRGSXITBHHPC-VVQHAZRASA-N
  • common name:
    • ergosta-5,7-dienol
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.